C49H46N6O10 — CID 161222484
2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid;2-amino-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid;9H-xanthen-9-ylurea (PubChem CID 161222484) has the molecular formula C49H46N6O10 and a molecular weight of 878.94 g/mol. Its IUPAC name is 2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid;2-amino-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid;9H-xanthen-9-ylurea.
| Compound Name | 2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid;2-amino-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid;9H-xanthen-9-ylurea |
|---|---|
| PubChem CID | 161222484 |
| Molecular Formula | C49H46N6O10 |
| Molecular Weight | 878.94 g/mol |
| Exact Mass | 878.33 |
| IUPAC Name | 2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid;2-amino-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid;9H-xanthen-9-ylurea |
| SMILES | NC(=O)NC1c2ccccc2Oc2ccccc21.NC(CC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O.NC(CCC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
| InChI | InChI=1S/C18H18N2O4.C17H16N2O4.C14H12N2O2/c19-13(18(22)23)9-10-16(21)20-17-11-5-1-3-7-14(11)24-15-8-4-2-6-12(15)17;18-12(17(21)22)9-15(20)19-16-10-5-1-3-7-13(10)23-14-8-4-2-6-11(14)16;15-14(17)16-13-9-5-1-3-7-11(9)18-12-8-4-2-6-10(12)13/h1-8,13,17H,9-10,19H2,(H,20,21)(H,22,23);1-8,12,16H,9,18H2,(H,19,20)(H,21,22);1-8,13H,(H3,15,16,17) |
| InChIKey | UXRVLJDXWMFDHE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 267.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.94 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |