C17H16N2O4 — CID 138717560
(2S)-2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid (PubChem CID 138717560) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2S)-2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid.
| Compound Name | (2S)-2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid |
|---|---|
| PubChem CID | 138717560 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-2-amino-4-oxo-4-(9H-xanthen-9-ylamino)butanoic acid |
| SMILES | N[C@@H](CC(=O)NC1c2ccccc2Oc2ccccc21)C(=O)O |
| InChI | InChI=1S/C17H16N2O4/c18-12(17(21)22)9-15(20)19-16-10-5-1-3-7-13(10)23-14-8-4-2-6-11(14)16/h1-8,12,16H,9,18H2,(H,19,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | HEEQJJWHDJTPLU-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |