C25H19N3O3S — CID 56547481
N-[4-[2-oxo-2-(9H-xanthen-9-ylamino)ethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 56547481) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(9H-xanthen-9-ylamino)ethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-oxo-2-(9H-xanthen-9-ylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56547481 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[4-[2-oxo-2-(9H-xanthen-9-ylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)NC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H19N3O3S/c29-22(14-17-15-32-25(26-17)28-24(30)16-8-2-1-3-9-16)27-23-18-10-4-6-12-20(18)31-21-13-7-5-11-19(21)23/h1-13,15,23H,14H2,(H,27,29)(H,26,28,30) |
| InChIKey | PRKHGKILZNMPBX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |