C19H31N5O — CID 86925418
N-[3-(azepan-1-yl)propyl]-1-pyrazin-2-ylpiperidine-4-carboxamide (PubChem CID 86925418) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-pyrazin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-pyrazin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 86925418 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-pyrazin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)C1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C19H31N5O/c25-19(22-8-5-13-23-11-3-1-2-4-12-23)17-6-14-24(15-7-17)18-16-20-9-10-21-18/h9-10,16-17H,1-8,11-15H2,(H,22,25) |
| InChIKey | RFZSZDYVJGVQPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|