C16H22N6O — CID 37392327
(3R)-1-pyrazin-2-yl-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 37392327) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is (3R)-1-pyrazin-2-yl-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-pyrazin-2-yl-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 37392327 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3R)-1-pyrazin-2-yl-N-(3-pyrazol-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCn1cccn1)[C@@H]1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C16H22N6O/c23-16(19-5-2-10-22-11-3-6-20-22)14-4-1-9-21(13-14)15-12-17-7-8-18-15/h3,6-8,11-12,14H,1-2,4-5,9-10,13H2,(H,19,23)/t14-/m1/s1 |
| InChIKey | UDZHWRCWBUKVCY-CQSZACIVSA-N |
| XLogP | 1.10 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|