C18H29N5O2 — CID 71984965
1-N-cyclopentyl-3-N-(3-pyrazol-1-ylpropyl)piperidine-1,3-dicarboxamide (PubChem CID 71984965) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-N-cyclopentyl-3-N-(3-pyrazol-1-ylpropyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-3-N-(3-pyrazol-1-ylpropyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71984965 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 1-N-cyclopentyl-3-N-(3-pyrazol-1-ylpropyl)piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCCCn1cccn1)C1CCCN(C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H29N5O2/c24-17(19-9-4-12-23-13-5-10-20-23)15-6-3-11-22(14-15)18(25)21-16-7-1-2-8-16/h5,10,13,15-16H,1-4,6-9,11-12,14H2,(H,19,24)(H,21,25) |
| InChIKey | MBFAOZXEUNNDMK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|