C16H21F3N2O4S — CID 86929033
2-methyl-1-methylsulfonyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 86929033) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 2-methyl-1-methylsulfonyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 86929033 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | CC1Cc2cc(C(=O)NCCCOCC(F)(F)F)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C16H21F3N2O4S/c1-11-8-13-9-12(4-5-14(13)21(11)26(2,23)24)15(22)20-6-3-7-25-10-16(17,18)19/h4-5,9,11H,3,6-8,10H2,1-2H3,(H,20,22) |
| InChIKey | WWAHXVQXINAHHH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|