C20H24N2O4S — CID 9224172
(2R)-2-methyl-N-[2-(3-methylphenoxy)ethyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 9224172) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (2R)-2-methyl-N-[2-(3-methylphenoxy)ethyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | (2R)-2-methyl-N-[2-(3-methylphenoxy)ethyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 9224172 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2R)-2-methyl-N-[2-(3-methylphenoxy)ethyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | Cc1cccc(OCCNC(=O)c2ccc3c(c2)C[C@@H](C)N3S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-14-5-4-6-18(11-14)26-10-9-21-20(23)16-7-8-19-17(13-16)12-15(2)22(19)27(3,24)25/h4-8,11,13,15H,9-10,12H2,1-3H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | DJYSLZDFPZGLDI-OAHLLOKOSA-N |
| XLogP | 2.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|