C20H16Cl2N2O3 — CID 86933421
N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-2-(6-chloro-3-pyridinyl)acetamide (PubChem CID 86933421) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-2-(6-chloro-3-pyridinyl)acetamide.
| Compound Name | N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-2-(6-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 86933421 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-2-(6-chloro-3-pyridinyl)acetamide |
| SMILES | COc1ccc(Oc2ccc(Cl)cc2NC(=O)Cc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-26-15-4-6-16(7-5-15)27-18-8-3-14(21)11-17(18)24-20(25)10-13-2-9-19(22)23-12-13/h2-9,11-12H,10H2,1H3,(H,24,25) |
| InChIKey | PJBLXKWVYGDRPQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|