C20H25ClN2O3 — CID 60561036
N-(5-chloro-2-methoxyphenyl)-2-[3-(4-methoxyphenyl)propyl-methylamino]acetamide (PubChem CID 60561036) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[3-(4-methoxyphenyl)propyl-methylamino]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(4-methoxyphenyl)propyl-methylamino]acetamide |
|---|---|
| PubChem CID | 60561036 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(4-methoxyphenyl)propyl-methylamino]acetamide |
| SMILES | COc1ccc(CCCN(C)CC(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-23(12-4-5-15-6-9-17(25-2)10-7-15)14-20(24)22-18-13-16(21)8-11-19(18)26-3/h6-11,13H,4-5,12,14H2,1-3H3,(H,22,24) |
| InChIKey | JRFFRLGUVHXNON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |