C24H26N4O2 — CID 86934156
N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)-1-phenylpyrazole-3-carboxamide (PubChem CID 86934156) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86934156 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1ccc(N(CC(=O)N2CCCCC2)C(=O)c2ccn(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-19-10-12-20(13-11-19)27(18-23(29)26-15-6-3-7-16-26)24(30)22-14-17-28(25-22)21-8-4-2-5-9-21/h2,4-5,8-14,17H,3,6-7,15-16,18H2,1H3 |
| InChIKey | RRTSVIJTDLNOBO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |