C21H20N4O3S2 — CID 86935986
4-(3-cyanopropylsulfonyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 86935986) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-(3-cyanopropylsulfonyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 4-(3-cyanopropylsulfonyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 86935986 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-(3-cyanopropylsulfonyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)CCCC#N)cc1)c1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C21H20N4O3S2/c1-15(21-25-19(14-29-21)17-5-4-11-23-13-17)24-20(26)16-6-8-18(9-7-16)30(27,28)12-3-2-10-22/h4-9,11,13-15H,2-3,12H2,1H3,(H,24,26) |
| InChIKey | JNFNKZIHUULKSJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|