C20H16F3N3OS — CID 86936040
(E)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 86936040) has the molecular formula C20H16F3N3OS and a molecular weight of 403.43 g/mol. Its IUPAC name is (E)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86936040 |
| Molecular Formula | C20H16F3N3OS |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (E)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(C(F)(F)F)cc1)c1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C20H16F3N3OS/c1-13(19-26-17(12-28-19)15-3-2-10-24-11-15)25-18(27)9-6-14-4-7-16(8-5-14)20(21,22)23/h2-13H,1H3,(H,25,27)/b9-6+ |
| InChIKey | ZOWZIIZATLPERS-RMKNXTFCSA-N |
| XLogP | 5.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|