C24H27N3O3S — CID 86936041
(E)-3-(4-butoxy-3-methoxyphenyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide (PubChem CID 86936041) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-methoxyphenyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-butoxy-3-methoxyphenyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86936041 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (E)-3-(4-butoxy-3-methoxyphenyl)-N-[1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)NC(C)c2nc(-c3cccnc3)cs2)cc1OC |
| InChI | InChI=1S/C24H27N3O3S/c1-4-5-13-30-21-10-8-18(14-22(21)29-3)9-11-23(28)26-17(2)24-27-20(16-31-24)19-7-6-12-25-15-19/h6-12,14-17H,4-5,13H2,1-3H3,(H,26,28)/b11-9+ |
| InChIKey | OWQSMFMNSJZINW-PKNBQFBNSA-N |
| XLogP | 5.28 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|