C18H14ClN5OS2 — CID 103599303
3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide (PubChem CID 103599303) has the molecular formula C18H14ClN5OS2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 103599303 |
| Molecular Formula | C18H14ClN5OS2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[1-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)C=Cc1c(Cl)nc2sccn12)c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C18H14ClN5OS2/c1-11(17-22-13(10-27-17)12-4-6-20-7-5-12)21-15(25)3-2-14-16(19)23-18-24(14)8-9-26-18/h2-11H,1H3,(H,21,25) |
| InChIKey | CCNCMAVLCLSRSB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|