C24H21N3O2S — CID 86936286
N'-[naphthalen-1-yl(phenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 86936286) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-[naphthalen-1-yl(phenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[naphthalen-1-yl(phenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 86936286 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N'-[naphthalen-1-yl(phenyl)methyl]-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)NC(c1ccccc1)c1cccc2ccccc12)Nc1nccs1 |
| InChI | InChI=1S/C24H21N3O2S/c28-21(13-14-22(29)27-24-25-15-16-30-24)26-23(18-8-2-1-3-9-18)20-12-6-10-17-7-4-5-11-19(17)20/h1-12,15-16,23H,13-14H2,(H,26,28)(H,25,27,29) |
| InChIKey | PALFPBMVQOVLIY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |