C18H27Cl2N3O3S — CID 86936983
N-(2,6-dichlorophenyl)-3-(4-pentylsulfonylpiperazin-1-yl)propanamide (PubChem CID 86936983) has the molecular formula C18H27Cl2N3O3S and a molecular weight of 436.41 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-(4-pentylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-(4-pentylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 86936983 |
| Molecular Formula | C18H27Cl2N3O3S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-(4-pentylsulfonylpiperazin-1-yl)propanamide |
| SMILES | CCCCCS(=O)(=O)N1CCN(CCC(=O)Nc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H27Cl2N3O3S/c1-2-3-4-14-27(25,26)23-12-10-22(11-13-23)9-8-17(24)21-18-15(19)6-5-7-16(18)20/h5-7H,2-4,8-14H2,1H3,(H,21,24) |
| InChIKey | HPRWJNVYAMNMCR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|