C16H22FN3O2 — CID 86937809
N-[3-[(3-fluorobenzoyl)amino]propyl]-3-methylpyrrolidine-1-carboxamide (PubChem CID 86937809) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is N-[3-[(3-fluorobenzoyl)amino]propyl]-3-methylpyrrolidine-1-carboxamide.
| Compound Name | N-[3-[(3-fluorobenzoyl)amino]propyl]-3-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86937809 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[3-[(3-fluorobenzoyl)amino]propyl]-3-methylpyrrolidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCCCNC(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H22FN3O2/c1-12-6-9-20(11-12)16(22)19-8-3-7-18-15(21)13-4-2-5-14(17)10-13/h2,4-5,10,12H,3,6-9,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | AFMHXAMECSYNMB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|