C15H21FN2O3S — CID 124851079
(3S)-N-[3-(3-fluorophenyl)propyl]-3-methylsulfonylpyrrolidine-1-carboxamide (PubChem CID 124851079) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is (3S)-N-[3-(3-fluorophenyl)propyl]-3-methylsulfonylpyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-[3-(3-fluorophenyl)propyl]-3-methylsulfonylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124851079 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (3S)-N-[3-(3-fluorophenyl)propyl]-3-methylsulfonylpyrrolidine-1-carboxamide |
| SMILES | CS(=O)(=O)[C@H]1CCN(C(=O)NCCCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H21FN2O3S/c1-22(20,21)14-7-9-18(11-14)15(19)17-8-3-5-12-4-2-6-13(16)10-12/h2,4,6,10,14H,3,5,7-9,11H2,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | RTRMQVIJCMHQSV-AWEZNQCLSA-N |
| XLogP | 1.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|