C23H25F3N2O3 — CID 86938770
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 86938770) has the molecular formula C23H25F3N2O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 86938770 |
| Molecular Formula | C23H25F3N2O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(OC(F)(F)F)cc1)NCCCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H25F3N2O3/c24-23(25,26)31-20-10-7-17(8-11-20)9-12-21(29)27-14-3-6-22(30)28-15-13-18-4-1-2-5-19(18)16-28/h1-2,4-5,7-8,10-11H,3,6,9,12-16H2,(H,27,29) |
| InChIKey | NJYPDQBGIUTAII-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|