C24H23FN2O3 — CID 86939213
[1-(2-fluorobenzoyl)piperidin-4-yl] 2-(4-pyrrol-1-ylphenyl)acetate (PubChem CID 86939213) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is [1-(2-fluorobenzoyl)piperidin-4-yl] 2-(4-pyrrol-1-ylphenyl)acetate.
| Compound Name | [1-(2-fluorobenzoyl)piperidin-4-yl] 2-(4-pyrrol-1-ylphenyl)acetate |
|---|---|
| PubChem CID | 86939213 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [1-(2-fluorobenzoyl)piperidin-4-yl] 2-(4-pyrrol-1-ylphenyl)acetate |
| SMILES | O=C(Cc1ccc(-n2cccc2)cc1)OC1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23FN2O3/c25-22-6-2-1-5-21(22)24(29)27-15-11-20(12-16-27)30-23(28)17-18-7-9-19(10-8-18)26-13-3-4-14-26/h1-10,13-14,20H,11-12,15-17H2 |
| InChIKey | WIPNWSGCEAUNKQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |