C24H20N4O4 — CID 86940328
N-[3-[[(3-pyridin-4-yloxyphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 86940328) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[3-[[(3-pyridin-4-yloxyphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(3-pyridin-4-yloxyphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86940328 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[3-[[(3-pyridin-4-yloxyphenyl)carbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)c2ccco2)c1)Nc1cccc(Oc2ccncc2)c1 |
| InChI | InChI=1S/C24H20N4O4/c29-23(22-8-3-13-31-22)27-18-5-1-4-17(14-18)16-26-24(30)28-19-6-2-7-21(15-19)32-20-9-11-25-12-10-20/h1-15H,16H2,(H,27,29)(H2,26,28,30) |
| InChIKey | FCXRKHWTTSYUFM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |