C17H14ClN3O2 — CID 133351732
N-[3-[[(3-chloro-4-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 133351732) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-[3-[[(3-chloro-4-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(3-chloro-4-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133351732 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[3-[[(3-chloro-4-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(CNc2ccncc2Cl)c1)c1ccco1 |
| InChI | InChI=1S/C17H14ClN3O2/c18-14-11-19-7-6-15(14)20-10-12-3-1-4-13(9-12)21-17(22)16-5-2-8-23-16/h1-9,11H,10H2,(H,19,20)(H,21,22) |
| InChIKey | VNDXUQWXYVFMFG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |