C22H16N4O2 — CID 133310527
N-[3-[[(2-cyanoquinolin-4-yl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 133310527) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[3-[[(2-cyanoquinolin-4-yl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(2-cyanoquinolin-4-yl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133310527 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[3-[[(2-cyanoquinolin-4-yl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | N#Cc1cc(NCc2cccc(NC(=O)c3ccco3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C22H16N4O2/c23-13-17-12-20(18-7-1-2-8-19(18)25-17)24-14-15-5-3-6-16(11-15)26-22(27)21-9-4-10-28-21/h1-12H,14H2,(H,24,25)(H,26,27) |
| InChIKey | MROOQUFKTAKMGL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |