C17H26FNO2 — CID 86940685
N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]pentanamide (PubChem CID 86940685) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]pentanamide.
| Compound Name | N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 86940685 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]pentanamide |
| SMILES | CCCCC(=O)NC(COc1ccccc1F)C(C)(C)C |
| InChI | InChI=1S/C17H26FNO2/c1-5-6-11-16(20)19-15(17(2,3)4)12-21-14-10-8-7-9-13(14)18/h7-10,15H,5-6,11-12H2,1-4H3,(H,19,20) |
| InChIKey | FYZUEPPHSISJFW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |