C16H20Cl2FNO2 — CID 86940721
2,2-dichloro-N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide (PubChem CID 86940721) has the molecular formula C16H20Cl2FNO2 and a molecular weight of 348.25 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86940721 |
| Molecular Formula | C16H20Cl2FNO2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2,2-dichloro-N-[1-(2-fluorophenoxy)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)C(COc1ccccc1F)NC(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C16H20Cl2FNO2/c1-15(2,3)13(20-14(21)10-8-16(10,17)18)9-22-12-7-5-4-6-11(12)19/h4-7,10,13H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | BFHANFBLQHJKJK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|