C26H27N3O3 — CID 86942258
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]prop-1-en-2-yl]benzamide (PubChem CID 86942258) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 86942258 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[(2-phenyl-2-pyrrolidin-1-ylethyl)amino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCCC1)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3/c30-25(21-12-5-2-6-13-21)28-23(18-22-14-9-17-32-22)26(31)27-19-24(29-15-7-8-16-29)20-10-3-1-4-11-20/h1-6,9-14,17-18,24H,7-8,15-16,19H2,(H,27,31)(H,28,30)/b23-18- |
| InChIKey | XECAQKKRYXHKQJ-NKFKGCMQSA-N |
| XLogP | 4.00 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|