C21H38N4O3S+2 — CID 8694284
tert-butyl-[3-[[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]propyl]azanium (PubChem CID 8694284) has the molecular formula C21H38N4O3S+2 and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl-[3-[[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]propyl]azanium.
| Compound Name | tert-butyl-[3-[[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 8694284 |
| Molecular Formula | C21H38N4O3S+2 |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl-[3-[[2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]propyl]azanium |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CC[NH+](CC(=O)NCCC[NH2+]C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H36N4O3S/c1-17-7-8-18(2)19(15-17)29(27,28)25-13-11-24(12-14-25)16-20(26)22-9-6-10-23-21(3,4)5/h7-8,15,23H,6,9-14,16H2,1-5H3,(H,22,26)/p+2 |
| InChIKey | ADZPIHYKFXZSOR-UHFFFAOYSA-P |
| XLogP | -0.94 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|