C24H37N3O3 — CID 86943213
1-[(3-cyclohexyloxyphenyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea (PubChem CID 86943213) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-[(3-cyclohexyloxyphenyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-[(3-cyclohexyloxyphenyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 86943213 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 1-[(3-cyclohexyloxyphenyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
| SMILES | CC(C)CC(=O)N1CCC(NC(=O)NCc2cccc(OC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C24H37N3O3/c1-18(2)15-23(28)27-13-11-20(12-14-27)26-24(29)25-17-19-7-6-10-22(16-19)30-21-8-4-3-5-9-21/h6-7,10,16,18,20-21H,3-5,8-9,11-15,17H2,1-2H3,(H2,25,26,29) |
| InChIKey | ICIYIWFMHFBQTQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |