C26H39N3O3 — CID 86943396
4-(cyclohexanecarbonylamino)-N-[(3-cyclohexyloxyphenyl)methyl]piperidine-1-carboxamide (PubChem CID 86943396) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-[(3-cyclohexyloxyphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-[(3-cyclohexyloxyphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86943396 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-[(3-cyclohexyloxyphenyl)methyl]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NCc2cccc(OC3CCCCC3)c2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C26H39N3O3/c30-25(21-9-3-1-4-10-21)28-22-14-16-29(17-15-22)26(31)27-19-20-8-7-13-24(18-20)32-23-11-5-2-6-12-23/h7-8,13,18,21-23H,1-6,9-12,14-17,19H2,(H,27,31)(H,28,30) |
| InChIKey | QJEZJFBANWEZIR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |