C21H28ClN5O — CID 86944435
2-chloro-6-(dimethylamino)-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]pyridine-4-carboxamide (PubChem CID 86944435) has the molecular formula C21H28ClN5O and a molecular weight of 401.94 g/mol. Its IUPAC name is 2-chloro-6-(dimethylamino)-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(dimethylamino)-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 86944435 |
| Molecular Formula | C21H28ClN5O |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-chloro-6-(dimethylamino)-N-[4-[2-(4-methylpiperazin-1-yl)ethyl]phenyl]pyridine-4-carboxamide |
| SMILES | CN1CCN(CCc2ccc(NC(=O)c3cc(Cl)nc(N(C)C)c3)cc2)CC1 |
| InChI | InChI=1S/C21H28ClN5O/c1-25(2)20-15-17(14-19(22)24-20)21(28)23-18-6-4-16(5-7-18)8-9-27-12-10-26(3)11-13-27/h4-7,14-15H,8-13H2,1-3H3,(H,23,28) |
| InChIKey | LPWFNURJVUGYSN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|