C14H17N3O3S — CID 86947050
N-[2-(methanesulfonamido)ethyl]-N-methylisoquinoline-4-carboxamide (PubChem CID 86947050) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-N-methylisoquinoline-4-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-N-methylisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 86947050 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-N-methylisoquinoline-4-carboxamide |
| SMILES | CN(CCNS(C)(=O)=O)C(=O)c1cncc2ccccc12 |
| InChI | InChI=1S/C14H17N3O3S/c1-17(8-7-16-21(2,19)20)14(18)13-10-15-9-11-5-3-4-6-12(11)13/h3-6,9-10,16H,7-8H2,1-2H3 |
| InChIKey | UVWUKGBUJRKLLA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |