C17H16ClF2NO — CID 86948842
N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2-(2-fluorophenyl)acetamide (PubChem CID 86948842) has the molecular formula C17H16ClF2NO and a molecular weight of 323.77 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 86948842 |
| Molecular Formula | C17H16ClF2NO |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2-(2-fluorophenyl)acetamide |
| SMILES | CC(C)(NC(=O)Cc1ccccc1F)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H16ClF2NO/c1-17(2,13-8-7-12(19)10-14(13)18)21-16(22)9-11-5-3-4-6-15(11)20/h3-8,10H,9H2,1-2H3,(H,21,22) |
| InChIKey | WCEVMDSZYGGSQG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |