C16H13ClF3NO — CID 86948958
N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2,3-difluorobenzamide (PubChem CID 86948958) has the molecular formula C16H13ClF3NO and a molecular weight of 327.73 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2,3-difluorobenzamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 86948958 |
| Molecular Formula | C16H13ClF3NO |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenyl)propan-2-yl]-2,3-difluorobenzamide |
| SMILES | CC(C)(NC(=O)c1cccc(F)c1F)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H13ClF3NO/c1-16(2,11-7-6-9(18)8-12(11)17)21-15(22)10-4-3-5-13(19)14(10)20/h3-8H,1-2H3,(H,21,22) |
| InChIKey | AIHCTXWUXINEQJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |