C16H13Cl2F2NO — CID 110445693
N-[2-(2,4-dichlorophenyl)propan-2-yl]-3,4-difluorobenzamide (PubChem CID 110445693) has the molecular formula C16H13Cl2F2NO and a molecular weight of 344.19 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)propan-2-yl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110445693 |
| Molecular Formula | C16H13Cl2F2NO |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]-3,4-difluorobenzamide |
| SMILES | CC(C)(NC(=O)c1ccc(F)c(F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2F2NO/c1-16(2,11-5-4-10(17)8-12(11)18)21-15(22)9-3-6-13(19)14(20)7-9/h3-8H,1-2H3,(H,21,22) |
| InChIKey | TXQUSGIYYULKCF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |