C14H17Cl2NO2 — CID 110444555
N-[2-(2,4-dichlorophenyl)propan-2-yl]oxolane-2-carboxamide (PubChem CID 110444555) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)propan-2-yl]oxolane-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 110444555 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]oxolane-2-carboxamide |
| SMILES | CC(C)(NC(=O)C1CCCO1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(2,10-6-5-9(15)8-11(10)16)17-13(18)12-4-3-7-19-12/h5-6,8,12H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | JDNWBTIEIPFXRM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |