C14H18N2O4 — CID 96559481
(2S)-N-[2-(4-nitrophenyl)propan-2-yl]oxolane-2-carboxamide (PubChem CID 96559481) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2S)-N-[2-(4-nitrophenyl)propan-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[2-(4-nitrophenyl)propan-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 96559481 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S)-N-[2-(4-nitrophenyl)propan-2-yl]oxolane-2-carboxamide |
| SMILES | CC(C)(NC(=O)[C@@H]1CCCO1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2,15-13(17)12-4-3-9-20-12)10-5-7-11(8-6-10)16(18)19/h5-8,12H,3-4,9H2,1-2H3,(H,15,17)/t12-/m0/s1 |
| InChIKey | UAULSXBGNYQEKM-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|