C18H20ClN5O3S — CID 86950155
ethyl N-[6-[[1-(2-chloroethyl)-3,5-dimethylpyrazole-4-carbonyl]amino]-1,3-benzothiazol-2-yl]carbamate (PubChem CID 86950155) has the molecular formula C18H20ClN5O3S and a molecular weight of 421.91 g/mol. Its IUPAC name is ethyl N-[6-[[1-(2-chloroethyl)-3,5-dimethylpyrazole-4-carbonyl]amino]-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | ethyl N-[6-[[1-(2-chloroethyl)-3,5-dimethylpyrazole-4-carbonyl]amino]-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86950155 |
| Molecular Formula | C18H20ClN5O3S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | ethyl N-[6-[[1-(2-chloroethyl)-3,5-dimethylpyrazole-4-carbonyl]amino]-1,3-benzothiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2ccc(NC(=O)c3c(C)nn(CCCl)c3C)cc2s1 |
| InChI | InChI=1S/C18H20ClN5O3S/c1-4-27-18(26)22-17-21-13-6-5-12(9-14(13)28-17)20-16(25)15-10(2)23-24(8-7-19)11(15)3/h5-6,9H,4,7-8H2,1-3H3,(H,20,25)(H,21,22,26) |
| InChIKey | SCYWHOIGCXBJQL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|