C16H12Cl2N4O4S — CID 134140511
ethyl 2-[[6-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-2-yl]amino]-2-oxoacetate (PubChem CID 134140511) has the molecular formula C16H12Cl2N4O4S and a molecular weight of 427.27 g/mol. Its IUPAC name is ethyl 2-[[6-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[6-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 134140511 |
| Molecular Formula | C16H12Cl2N4O4S |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | ethyl 2-[[6-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]-1,3-benzothiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1nc2ccc(NC(=O)c3cc(Cl)c(Cl)[nH]3)cc2s1 |
| InChI | InChI=1S/C16H12Cl2N4O4S/c1-2-26-15(25)14(24)22-16-21-9-4-3-7(5-11(9)27-16)19-13(23)10-6-8(17)12(18)20-10/h3-6,20H,2H2,1H3,(H,19,23)(H,21,22,24) |
| InChIKey | RHSZXRQVJPPQHW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|