C18H14ClN3OS — CID 108745567
7-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide (PubChem CID 108745567) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is 7-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108745567 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 7-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide |
| SMILES | CCc1ccc2nc(NC(=O)c3cc4cccc(Cl)c4[nH]3)sc2c1 |
| InChI | InChI=1S/C18H14ClN3OS/c1-2-10-6-7-13-15(8-10)24-18(21-13)22-17(23)14-9-11-4-3-5-12(19)16(11)20-14/h3-9,20H,2H2,1H3,(H,21,22,23) |
| InChIKey | YZRJZIQCXWCBOX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |