C17H14N4O6S — CID 86950754
[4-[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone (PubChem CID 86950754) has the molecular formula C17H14N4O6S and a molecular weight of 402.39 g/mol. Its IUPAC name is [4-[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone.
| Compound Name | [4-[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 86950754 |
| Molecular Formula | C17H14N4O6S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [4-[5-(furan-2-yl)-1,3-oxazole-4-carbonyl]piperazin-1-yl]-(5-nitrothiophen-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])s1)N1CCN(C(=O)c2ncoc2-c2ccco2)CC1 |
| InChI | InChI=1S/C17H14N4O6S/c22-16(12-3-4-13(28-12)21(24)25)19-5-7-20(8-6-19)17(23)14-15(27-10-18-14)11-2-1-9-26-11/h1-4,9-10H,5-8H2 |
| InChIKey | PGJMFBMXUIHRBG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 122.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|