C22H26F2N2O3 — CID 86950916
2-(3,4-difluorophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)-2-phenylacetamide (PubChem CID 86950916) has the molecular formula C22H26F2N2O3 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)-2-phenylacetamide.
| Compound Name | 2-(3,4-difluorophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 86950916 |
| Molecular Formula | C22H26F2N2O3 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-N-(4-morpholin-4-ylbutan-2-yl)-2-phenylacetamide |
| SMILES | CC(CCN1CCOCC1)NC(=O)C(Oc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H26F2N2O3/c1-16(9-10-26-11-13-28-14-12-26)25-22(27)21(17-5-3-2-4-6-17)29-18-7-8-19(23)20(24)15-18/h2-8,15-16,21H,9-14H2,1H3,(H,25,27) |
| InChIKey | DRSMRTLKDFWHER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |