C18H27NOS — CID 86952952
3-cyclohexyl-1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]propan-1-one (PubChem CID 86952952) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 86952952 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 3-cyclohexyl-1-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]propan-1-one |
| SMILES | Cc1ccc(C2CCCN2C(=O)CCC2CCCCC2)s1 |
| InChI | InChI=1S/C18H27NOS/c1-14-9-11-17(21-14)16-8-5-13-19(16)18(20)12-10-15-6-3-2-4-7-15/h9,11,15-16H,2-8,10,12-13H2,1H3 |
| InChIKey | YNEXNTJZASYMIU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |