C20H33N3O3 — CID 86953624
1-[(1-butylpiperidin-2-yl)methyl]-3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]urea (PubChem CID 86953624) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[(1-butylpiperidin-2-yl)methyl]-3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[(1-butylpiperidin-2-yl)methyl]-3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86953624 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 1-[(1-butylpiperidin-2-yl)methyl]-3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]urea |
| SMILES | CCCCN1CCCCC1CNC(=O)NCCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H33N3O3/c1-3-4-12-23-13-6-5-7-17(23)15-22-20(25)21-11-10-16-8-9-18(24)19(14-16)26-2/h8-9,14,17,24H,3-7,10-13,15H2,1-2H3,(H2,21,22,25) |
| InChIKey | SQMJYBSKGHGUKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |