C20H30ClN3O4 — CID 47090811
4-(2-amino-2-oxoethoxy)-N-[(1-butylpiperidin-2-yl)methyl]-3-chloro-5-methoxybenzamide (PubChem CID 47090811) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[(1-butylpiperidin-2-yl)methyl]-3-chloro-5-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[(1-butylpiperidin-2-yl)methyl]-3-chloro-5-methoxybenzamide |
|---|---|
| PubChem CID | 47090811 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[(1-butylpiperidin-2-yl)methyl]-3-chloro-5-methoxybenzamide |
| SMILES | CCCCN1CCCCC1CNC(=O)c1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C20H30ClN3O4/c1-3-4-8-24-9-6-5-7-15(24)12-23-20(26)14-10-16(21)19(17(11-14)27-2)28-13-18(22)25/h10-11,15H,3-9,12-13H2,1-2H3,(H2,22,25)(H,23,26) |
| InChIKey | DXNRFZQYKOOXRV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |