C20H25ClN2O4 — CID 18138322
N-(2-adamantyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzamide (PubChem CID 18138322) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is N-(2-adamantyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzamide.
| Compound Name | N-(2-adamantyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzamide |
|---|---|
| PubChem CID | 18138322 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-(2-adamantyl)-4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC2C3CC4CC(C3)CC2C4)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C20H25ClN2O4/c1-26-16-8-14(7-15(21)19(16)27-9-17(22)24)20(25)23-18-12-3-10-2-11(5-12)6-13(18)4-10/h7-8,10-13,18H,2-6,9H2,1H3,(H2,22,24)(H,23,25) |
| InChIKey | VRSHEHPWINRWMX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |