C15H23BrN2O3S — CID 86956606
tert-butyl N-[1-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutan-2-yl]carbamate (PubChem CID 86956606) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is tert-butyl N-[1-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86956606 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | tert-butyl N-[1-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(CNC(=O)c1csc(Br)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23BrN2O3S/c1-9(2)11(18-14(20)21-15(3,4)5)7-17-13(19)10-6-12(16)22-8-10/h6,8-9,11H,7H2,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | ONRIJXAKBGIIFM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |