C23H35N3O3 — CID 86958417
4-[4-[1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-1-oxopropan-2-yl]oxyphenyl]butan-2-one (PubChem CID 86958417) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[4-[1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-1-oxopropan-2-yl]oxyphenyl]butan-2-one.
| Compound Name | 4-[4-[1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-1-oxopropan-2-yl]oxyphenyl]butan-2-one |
|---|---|
| PubChem CID | 86958417 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 4-[4-[1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-1-oxopropan-2-yl]oxyphenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(OC(C)C(=O)N2CCN(C3CCCN(C)C3)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O3/c1-18(27)6-7-20-8-10-22(11-9-20)29-19(2)23(28)26-15-13-25(14-16-26)21-5-4-12-24(3)17-21/h8-11,19,21H,4-7,12-17H2,1-3H3 |
| InChIKey | FCSIMEYSRXDZQD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |