C19H20BrFN2OS — CID 86960802
(E)-3-(5-bromothiophen-3-yl)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylprop-2-enamide (PubChem CID 86960802) has the molecular formula C19H20BrFN2OS and a molecular weight of 423.35 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-3-yl)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-3-yl)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 86960802 |
| Molecular Formula | C19H20BrFN2OS |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (E)-3-(5-bromothiophen-3-yl)-N-[1-(4-fluorophenyl)piperidin-4-yl]-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1csc(Br)c1)C1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20BrFN2OS/c1-22(19(24)7-2-14-12-18(20)25-13-14)16-8-10-23(11-9-16)17-5-3-15(21)4-6-17/h2-7,12-13,16H,8-11H2,1H3/b7-2+ |
| InChIKey | ZPZQIUDPLKEZDG-FARCUNLSSA-N |
| XLogP | 4.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|