C23H23F3N2O4 — CID 86960898
[4-(ethylcarbamoyl)phenyl] 1-methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylate (PubChem CID 86960898) has the molecular formula C23H23F3N2O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)phenyl] 1-methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylate.
| Compound Name | [4-(ethylcarbamoyl)phenyl] 1-methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 86960898 |
| Molecular Formula | C23H23F3N2O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [4-(ethylcarbamoyl)phenyl] 1-methyl-6-oxo-2-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylate |
| SMILES | CCNC(=O)c1ccc(OC(=O)C2CCC(=O)N(C)C2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H23F3N2O4/c1-3-27-21(30)15-6-10-17(11-7-15)32-22(31)18-12-13-19(29)28(2)20(18)14-4-8-16(9-5-14)23(24,25)26/h4-11,18,20H,3,12-13H2,1-2H3,(H,27,30) |
| InChIKey | PVCPYKHUBVXUPW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|